C14H16N4O2S3 — CID 9441448
(2R)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide (PubChem CID 9441448) has the molecular formula C14H16N4O2S3 and a molecular weight of 368.51 g/mol. Its IUPAC name is (2R)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 9441448 |
| Molecular Formula | C14H16N4O2S3 |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | (2R)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide |
| SMILES | CCSc1nnc(NC(=O)[C@H]2CCCN2C(=O)c2cccs2)s1 |
| InChI | InChI=1S/C14H16N4O2S3/c1-2-21-14-17-16-13(23-14)15-11(19)9-5-3-7-18(9)12(20)10-6-4-8-22-10/h4,6,8-9H,2-3,5,7H2,1H3,(H,15,16,19)/t9-/m1/s1 |
| InChIKey | JWGNSMKJDNLCHB-SECBINFHSA-N |
| XLogP | 2.95 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|