C10H8ClN5O3S2 — CID 7760130
2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(5-chloro-2-nitrophenyl)acetamide (PubChem CID 7760130) has the molecular formula C10H8ClN5O3S2 and a molecular weight of 345.79 g/mol. Its IUPAC name is 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(5-chloro-2-nitrophenyl)acetamide.
| Compound Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(5-chloro-2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 7760130 |
| Molecular Formula | C10H8ClN5O3S2 |
| Molecular Weight | 345.79 g/mol |
| Exact Mass | 344.98 |
| IUPAC Name | 2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-N-(5-chloro-2-nitrophenyl)acetamide |
| SMILES | Nc1nnc(SCC(=O)Nc2cc(Cl)ccc2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C10H8ClN5O3S2/c11-5-1-2-7(16(18)19)6(3-5)13-8(17)4-20-10-15-14-9(12)21-10/h1-3H,4H2,(H2,12,14)(H,13,17) |
| InChIKey | ZBWAQEJHPYQYJK-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.79 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|