C10H7FN4O3S2 — CID 4781027
N-(5-fluoro-2-nitrophenyl)-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetamide (PubChem CID 4781027) has the molecular formula C10H7FN4O3S2 and a molecular weight of 314.32 g/mol. Its IUPAC name is N-(5-fluoro-2-nitrophenyl)-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetamide.
| Compound Name | N-(5-fluoro-2-nitrophenyl)-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 4781027 |
| Molecular Formula | C10H7FN4O3S2 |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 313.99 |
| IUPAC Name | N-(5-fluoro-2-nitrophenyl)-2-(1,3,4-thiadiazol-2-ylsulfanyl)acetamide |
| SMILES | O=C(CSc1nncs1)Nc1cc(F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H7FN4O3S2/c11-6-1-2-8(15(17)18)7(3-6)13-9(16)4-19-10-14-12-5-20-10/h1-3,5H,4H2,(H,13,16) |
| InChIKey | NDBCQWYKBXAKGO-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|