C13H14BrFN4O2S2 — CID 42975175
N-(4-bromo-2-fluorophenyl)-2-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 42975175) has the molecular formula C13H14BrFN4O2S2 and a molecular weight of 421.32 g/mol. Its IUPAC name is N-(4-bromo-2-fluorophenyl)-2-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-(4-bromo-2-fluorophenyl)-2-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 42975175 |
| Molecular Formula | C13H14BrFN4O2S2 |
| Molecular Weight | 421.32 g/mol |
| Exact Mass | 419.97 |
| IUPAC Name | N-(4-bromo-2-fluorophenyl)-2-[[5-(2-methoxyethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | COCCNc1nnc(SCC(=O)Nc2ccc(Br)cc2F)s1 |
| InChI | InChI=1S/C13H14BrFN4O2S2/c1-21-5-4-16-12-18-19-13(23-12)22-7-11(20)17-10-3-2-8(14)6-9(10)15/h2-3,6H,4-5,7H2,1H3,(H,16,18)(H,17,20) |
| InChIKey | GVACUMMZGHWOAW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.32 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|