C22H22ClN5O2S2 — CID 4882531
4-N-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1-N-phenylpiperidine-1,4-dicarboxamide (PubChem CID 4882531) has the molecular formula C22H22ClN5O2S2 and a molecular weight of 488.04 g/mol. Its IUPAC name is 4-N-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1-N-phenylpiperidine-1,4-dicarboxamide.
| Compound Name | 4-N-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1-N-phenylpiperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 4882531 |
| Molecular Formula | C22H22ClN5O2S2 |
| Molecular Weight | 488.04 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | 4-N-[5-[(4-chlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1-N-phenylpiperidine-1,4-dicarboxamide |
| SMILES | O=C(Nc1nnc(SCc2ccc(Cl)cc2)s1)C1CCN(C(=O)Nc2ccccc2)CC1 |
| InChI | InChI=1S/C22H22ClN5O2S2/c23-17-8-6-15(7-9-17)14-31-22-27-26-20(32-22)25-19(29)16-10-12-28(13-11-16)21(30)24-18-4-2-1-3-5-18/h1-9,16H,10-14H2,(H,24,30)(H,25,26,29) |
| InChIKey | NPOMQYLWDLTUCP-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.04 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|