C16H16Cl2N2O4S — CID 4665186
ethyl N-[4-[(2,4-dichlorophenyl)methylsulfamoyl]phenyl]carbamate (PubChem CID 4665186) has the molecular formula C16H16Cl2N2O4S and a molecular weight of 403.29 g/mol. Its IUPAC name is ethyl N-[4-[(2,4-dichlorophenyl)methylsulfamoyl]phenyl]carbamate.
| Compound Name | ethyl N-[4-[(2,4-dichlorophenyl)methylsulfamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 4665186 |
| Molecular Formula | C16H16Cl2N2O4S |
| Molecular Weight | 403.29 g/mol |
| Exact Mass | 402.02 |
| IUPAC Name | ethyl N-[4-[(2,4-dichlorophenyl)methylsulfamoyl]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(S(=O)(=O)NCc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C16H16Cl2N2O4S/c1-2-24-16(21)20-13-5-7-14(8-6-13)25(22,23)19-10-11-3-4-12(17)9-15(11)18/h3-9,19H,2,10H2,1H3,(H,20,21) |
| InChIKey | GPLPVHROYZCJAQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.29 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |