C14H25N5O3S2 — CID 125053761
N-[5-[3-[(3S)-3-methylpiperidin-1-yl]propylsulfamoyl]-1,3,4-thiadiazol-2-yl]propanamide (PubChem CID 125053761) has the molecular formula C14H25N5O3S2 and a molecular weight of 375.52 g/mol. Its IUPAC name is N-[5-[3-[(3S)-3-methylpiperidin-1-yl]propylsulfamoyl]-1,3,4-thiadiazol-2-yl]propanamide.
| Compound Name | N-[5-[3-[(3S)-3-methylpiperidin-1-yl]propylsulfamoyl]-1,3,4-thiadiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 125053761 |
| Molecular Formula | C14H25N5O3S2 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | N-[5-[3-[(3S)-3-methylpiperidin-1-yl]propylsulfamoyl]-1,3,4-thiadiazol-2-yl]propanamide |
| SMILES | CCC(=O)Nc1nnc(S(=O)(=O)NCCCN2CCC[C@H](C)C2)s1 |
| InChI | InChI=1S/C14H25N5O3S2/c1-3-12(20)16-13-17-18-14(23-13)24(21,22)15-7-5-9-19-8-4-6-11(2)10-19/h11,15H,3-10H2,1-2H3,(H,16,17,20)/t11-/m0/s1 |
| InChIKey | PWPUKAISRFUJSE-NSHDSACASA-N |
| XLogP | 1.29 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|