C11H18N4O3S2 — CID 95875500
N-[5-[(3R)-3-methylpiperidin-1-yl]sulfonyl-1,3,4-thiadiazol-2-yl]propanamide (PubChem CID 95875500) has the molecular formula C11H18N4O3S2 and a molecular weight of 318.42 g/mol. Its IUPAC name is N-[5-[(3R)-3-methylpiperidin-1-yl]sulfonyl-1,3,4-thiadiazol-2-yl]propanamide.
| Compound Name | N-[5-[(3R)-3-methylpiperidin-1-yl]sulfonyl-1,3,4-thiadiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 95875500 |
| Molecular Formula | C11H18N4O3S2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | N-[5-[(3R)-3-methylpiperidin-1-yl]sulfonyl-1,3,4-thiadiazol-2-yl]propanamide |
| SMILES | CCC(=O)Nc1nnc(S(=O)(=O)N2CCC[C@@H](C)C2)s1 |
| InChI | InChI=1S/C11H18N4O3S2/c1-3-9(16)12-10-13-14-11(19-10)20(17,18)15-6-4-5-8(2)7-15/h8H,3-7H2,1-2H3,(H,12,13,16)/t8-/m1/s1 |
| InChIKey | LGSNDBMIQYHUGI-MRVPVSSYSA-N |
| XLogP | 1.31 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|