C16H19ClN4O3S3 — CID 22517544
2-(4-chlorophenyl)sulfanyl-N-[5-(4-methylpiperidin-1-yl)sulfonyl-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 22517544) has the molecular formula C16H19ClN4O3S3 and a molecular weight of 447.01 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-N-[5-(4-methylpiperidin-1-yl)sulfonyl-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-N-[5-(4-methylpiperidin-1-yl)sulfonyl-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 22517544 |
| Molecular Formula | C16H19ClN4O3S3 |
| Molecular Weight | 447.01 g/mol |
| Exact Mass | 446.03 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-N-[5-(4-methylpiperidin-1-yl)sulfonyl-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | CC1CCN(S(=O)(=O)c2nnc(NC(=O)CSc3ccc(Cl)cc3)s2)CC1 |
| InChI | InChI=1S/C16H19ClN4O3S3/c1-11-6-8-21(9-7-11)27(23,24)16-20-19-15(26-16)18-14(22)10-25-13-4-2-12(17)3-5-13/h2-5,11H,6-10H2,1H3,(H,18,19,22) |
| InChIKey | BXJAZXLNVSAULD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.01 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|