C17H21ClN6O5S2 — CID 46271929
N-[5-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]sulfonyl-1,3,4-thiadiazol-2-yl]pentanamide (PubChem CID 46271929) has the molecular formula C17H21ClN6O5S2 and a molecular weight of 488.98 g/mol. Its IUPAC name is N-[5-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]sulfonyl-1,3,4-thiadiazol-2-yl]pentanamide.
| Compound Name | N-[5-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]sulfonyl-1,3,4-thiadiazol-2-yl]pentanamide |
|---|---|
| PubChem CID | 46271929 |
| Molecular Formula | C17H21ClN6O5S2 |
| Molecular Weight | 488.98 g/mol |
| Exact Mass | 488.07 |
| IUPAC Name | N-[5-[4-(4-chloro-2-nitrophenyl)piperazin-1-yl]sulfonyl-1,3,4-thiadiazol-2-yl]pentanamide |
| SMILES | CCCCC(=O)Nc1nnc(S(=O)(=O)N2CCN(c3ccc(Cl)cc3[N+](=O)[O-])CC2)s1 |
| InChI | InChI=1S/C17H21ClN6O5S2/c1-2-3-4-15(25)19-16-20-21-17(30-16)31(28,29)23-9-7-22(8-10-23)13-6-5-12(18)11-14(13)24(26)27/h5-6,11H,2-4,7-10H2,1H3,(H,19,20,25) |
| InChIKey | GKDLMOVBKHBGMT-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 138.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.98 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|