C19H18N4O4S2 — CID 100704967
3-methyl-N-[5-[(3-prop-2-enoxyphenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 100704967) has the molecular formula C19H18N4O4S2 and a molecular weight of 430.51 g/mol. Its IUPAC name is 3-methyl-N-[5-[(3-prop-2-enoxyphenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 3-methyl-N-[5-[(3-prop-2-enoxyphenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 100704967 |
| Molecular Formula | C19H18N4O4S2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | 3-methyl-N-[5-[(3-prop-2-enoxyphenyl)sulfamoyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | C=CCOc1cccc(NS(=O)(=O)c2nnc(NC(=O)c3cccc(C)c3)s2)c1 |
| InChI | InChI=1S/C19H18N4O4S2/c1-3-10-27-16-9-5-8-15(12-16)23-29(25,26)19-22-21-18(28-19)20-17(24)14-7-4-6-13(2)11-14/h3-9,11-12,23H,1,10H2,2H3,(H,20,21,24) |
| InChIKey | UOJJWTQWUBHJRK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|