C14H18N4O5S2 — CID 133187650
N-[5-[1-(2,5-dimethoxyphenyl)ethylsulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 133187650) has the molecular formula C14H18N4O5S2 and a molecular weight of 386.46 g/mol. Its IUPAC name is N-[5-[1-(2,5-dimethoxyphenyl)ethylsulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | N-[5-[1-(2,5-dimethoxyphenyl)ethylsulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 133187650 |
| Molecular Formula | C14H18N4O5S2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | N-[5-[1-(2,5-dimethoxyphenyl)ethylsulfamoyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | COc1ccc(OC)c(C(C)NS(=O)(=O)c2nnc(NC(C)=O)s2)c1 |
| InChI | InChI=1S/C14H18N4O5S2/c1-8(11-7-10(22-3)5-6-12(11)23-4)18-25(20,21)14-17-16-13(24-14)15-9(2)19/h5-8,18H,1-4H3,(H,15,16,19) |
| InChIKey | XJXDHIHQYTWIRQ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|