C18H21NO5S — CID 47072178
2-[3-[(2-ethyl-6-methylphenyl)sulfamoyl]-4-methoxyphenyl]acetic acid (PubChem CID 47072178) has the molecular formula C18H21NO5S and a molecular weight of 363.44 g/mol. Its IUPAC name is 2-[3-[(2-ethyl-6-methylphenyl)sulfamoyl]-4-methoxyphenyl]acetic acid.
| Compound Name | 2-[3-[(2-ethyl-6-methylphenyl)sulfamoyl]-4-methoxyphenyl]acetic acid |
|---|---|
| PubChem CID | 47072178 |
| Molecular Formula | C18H21NO5S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 2-[3-[(2-ethyl-6-methylphenyl)sulfamoyl]-4-methoxyphenyl]acetic acid |
| SMILES | CCc1cccc(C)c1NS(=O)(=O)c1cc(CC(=O)O)ccc1OC |
| InChI | InChI=1S/C18H21NO5S/c1-4-14-7-5-6-12(2)18(14)19-25(22,23)16-10-13(11-17(20)21)8-9-15(16)24-3/h5-10,19H,4,11H2,1-3H3,(H,20,21) |
| InChIKey | DVLZOBHMTSPXTN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |