C14H15N3O5S — CID 154840794
2-[4-methoxy-3-(pyridazin-3-ylmethylsulfamoyl)phenyl]acetic acid (PubChem CID 154840794) has the molecular formula C14H15N3O5S and a molecular weight of 337.36 g/mol. Its IUPAC name is 2-[4-methoxy-3-(pyridazin-3-ylmethylsulfamoyl)phenyl]acetic acid.
| Compound Name | 2-[4-methoxy-3-(pyridazin-3-ylmethylsulfamoyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 154840794 |
| Molecular Formula | C14H15N3O5S |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 2-[4-methoxy-3-(pyridazin-3-ylmethylsulfamoyl)phenyl]acetic acid |
| SMILES | COc1ccc(CC(=O)O)cc1S(=O)(=O)NCc1cccnn1 |
| InChI | InChI=1S/C14H15N3O5S/c1-22-12-5-4-10(8-14(18)19)7-13(12)23(20,21)16-9-11-3-2-6-15-17-11/h2-7,16H,8-9H2,1H3,(H,18,19) |
| InChIKey | KXPQMQGTNIPPJE-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 118.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |