C18H18N2O7S2 — CID 166597949
2-[3-(1,3-benzothiazol-7-ylmethylsulfamoyl)-4-methoxyphenyl]acetic acid;formic acid (PubChem CID 166597949) has the molecular formula C18H18N2O7S2 and a molecular weight of 438.48 g/mol. Its IUPAC name is 2-[3-(1,3-benzothiazol-7-ylmethylsulfamoyl)-4-methoxyphenyl]acetic acid;formic acid.
| Compound Name | 2-[3-(1,3-benzothiazol-7-ylmethylsulfamoyl)-4-methoxyphenyl]acetic acid;formic acid |
|---|---|
| PubChem CID | 166597949 |
| Molecular Formula | C18H18N2O7S2 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | 2-[3-(1,3-benzothiazol-7-ylmethylsulfamoyl)-4-methoxyphenyl]acetic acid;formic acid |
| SMILES | COc1ccc(CC(=O)O)cc1S(=O)(=O)NCc1cccc2ncsc12.O=CO |
| InChI | InChI=1S/C17H16N2O5S2.CH2O2/c1-24-14-6-5-11(8-16(20)21)7-15(14)26(22,23)19-9-12-3-2-4-13-17(12)25-10-18-13;2-1-3/h2-7,10,19H,8-9H2,1H3,(H,20,21);1H,(H,2,3) |
| InChIKey | IRMKFFNLNRPTRV-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 142.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|