C10H10ClN5O3S — CID 61051057
2-[4-[(2-chloro-3-pyridinyl)sulfonylamino]pyrazol-1-yl]acetamide (PubChem CID 61051057) has the molecular formula C10H10ClN5O3S and a molecular weight of 315.74 g/mol. Its IUPAC name is 2-[4-[(2-chloro-3-pyridinyl)sulfonylamino]pyrazol-1-yl]acetamide.
| Compound Name | 2-[4-[(2-chloro-3-pyridinyl)sulfonylamino]pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 61051057 |
| Molecular Formula | C10H10ClN5O3S |
| Molecular Weight | 315.74 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | 2-[4-[(2-chloro-3-pyridinyl)sulfonylamino]pyrazol-1-yl]acetamide |
| SMILES | NC(=O)Cn1cc(NS(=O)(=O)c2cccnc2Cl)cn1 |
| InChI | InChI=1S/C10H10ClN5O3S/c11-10-8(2-1-3-13-10)20(18,19)15-7-4-14-16(5-7)6-9(12)17/h1-5,15H,6H2,(H2,12,17) |
| InChIKey | UOGJOHBERAVLIV-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.74 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|