C13H9Cl3N2O4S — CID 100820121
4-hydroxy-N'-(2,4,5-trichlorophenyl)sulfonylbenzohydrazide (PubChem CID 100820121) has the molecular formula C13H9Cl3N2O4S and a molecular weight of 395.65 g/mol. Its IUPAC name is 4-hydroxy-N'-(2,4,5-trichlorophenyl)sulfonylbenzohydrazide.
| Compound Name | 4-hydroxy-N'-(2,4,5-trichlorophenyl)sulfonylbenzohydrazide |
|---|---|
| PubChem CID | 100820121 |
| Molecular Formula | C13H9Cl3N2O4S |
| Molecular Weight | 395.65 g/mol |
| Exact Mass | 393.93 |
| IUPAC Name | 4-hydroxy-N'-(2,4,5-trichlorophenyl)sulfonylbenzohydrazide |
| SMILES | O=C(NNS(=O)(=O)c1cc(Cl)c(Cl)cc1Cl)c1ccc(O)cc1 |
| InChI | InChI=1S/C13H9Cl3N2O4S/c14-9-5-11(16)12(6-10(9)15)23(21,22)18-17-13(20)7-1-3-8(19)4-2-7/h1-6,18-19H,(H,17,20) |
| InChIKey | WQJOGBKDNWRJJN-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.65 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|