C12H12BrN3O3S — CID 43258667
4-amino-N-(5-bromo-2-pyridinyl)-2-methoxybenzenesulfonamide (PubChem CID 43258667) has the molecular formula C12H12BrN3O3S and a molecular weight of 358.22 g/mol. Its IUPAC name is 4-amino-N-(5-bromo-2-pyridinyl)-2-methoxybenzenesulfonamide.
| Compound Name | 4-amino-N-(5-bromo-2-pyridinyl)-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 43258667 |
| Molecular Formula | C12H12BrN3O3S |
| Molecular Weight | 358.22 g/mol |
| Exact Mass | 356.98 |
| IUPAC Name | 4-amino-N-(5-bromo-2-pyridinyl)-2-methoxybenzenesulfonamide |
| SMILES | COc1cc(N)ccc1S(=O)(=O)Nc1ccc(Br)cn1 |
| InChI | InChI=1S/C12H12BrN3O3S/c1-19-10-6-9(14)3-4-11(10)20(17,18)16-12-5-2-8(13)7-15-12/h2-7H,14H2,1H3,(H,15,16) |
| InChIKey | CJFKPKIWIRGSBT-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.22 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|