C14H23BrN2O2S — CID 114379785
3-amino-5-bromo-N-(3-ethylpentan-3-yl)-2-methylbenzenesulfonamide (PubChem CID 114379785) has the molecular formula C14H23BrN2O2S and a molecular weight of 363.32 g/mol. Its IUPAC name is 3-amino-5-bromo-N-(3-ethylpentan-3-yl)-2-methylbenzenesulfonamide.
| Compound Name | 3-amino-5-bromo-N-(3-ethylpentan-3-yl)-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 114379785 |
| Molecular Formula | C14H23BrN2O2S |
| Molecular Weight | 363.32 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 3-amino-5-bromo-N-(3-ethylpentan-3-yl)-2-methylbenzenesulfonamide |
| SMILES | CCC(CC)(CC)NS(=O)(=O)c1cc(Br)cc(N)c1C |
| InChI | InChI=1S/C14H23BrN2O2S/c1-5-14(6-2,7-3)17-20(18,19)13-9-11(15)8-12(16)10(13)4/h8-9,17H,5-7,16H2,1-4H3 |
| InChIKey | UWPYPVFFKLFYKT-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.32 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|