C12H14BrN3O4S — CID 114379847
3-amino-5-bromo-N-(2,6-dioxopiperidin-3-yl)-2-methylbenzenesulfonamide (PubChem CID 114379847) has the molecular formula C12H14BrN3O4S and a molecular weight of 376.23 g/mol. Its IUPAC name is 3-amino-5-bromo-N-(2,6-dioxopiperidin-3-yl)-2-methylbenzenesulfonamide.
| Compound Name | 3-amino-5-bromo-N-(2,6-dioxopiperidin-3-yl)-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 114379847 |
| Molecular Formula | C12H14BrN3O4S |
| Molecular Weight | 376.23 g/mol |
| Exact Mass | 374.99 |
| IUPAC Name | 3-amino-5-bromo-N-(2,6-dioxopiperidin-3-yl)-2-methylbenzenesulfonamide |
| SMILES | Cc1c(N)cc(Br)cc1S(=O)(=O)NC1CCC(=O)NC1=O |
| InChI | InChI=1S/C12H14BrN3O4S/c1-6-8(14)4-7(13)5-10(6)21(19,20)16-9-2-3-11(17)15-12(9)18/h4-5,9,16H,2-3,14H2,1H3,(H,15,17,18) |
| InChIKey | NTHXFOKVXNLGKP-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.23 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|