C14H22BrN3O2S — CID 114379990
3-amino-5-bromo-N-(1,2-dimethylpiperidin-4-yl)-2-methylbenzenesulfonamide (PubChem CID 114379990) has the molecular formula C14H22BrN3O2S and a molecular weight of 376.32 g/mol. Its IUPAC name is 3-amino-5-bromo-N-(1,2-dimethylpiperidin-4-yl)-2-methylbenzenesulfonamide.
| Compound Name | 3-amino-5-bromo-N-(1,2-dimethylpiperidin-4-yl)-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 114379990 |
| Molecular Formula | C14H22BrN3O2S |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 3-amino-5-bromo-N-(1,2-dimethylpiperidin-4-yl)-2-methylbenzenesulfonamide |
| SMILES | Cc1c(N)cc(Br)cc1S(=O)(=O)NC1CCN(C)C(C)C1 |
| InChI | InChI=1S/C14H22BrN3O2S/c1-9-6-12(4-5-18(9)3)17-21(19,20)14-8-11(15)7-13(16)10(14)2/h7-9,12,17H,4-6,16H2,1-3H3 |
| InChIKey | RXDVYDOBBCRUNT-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|