C13H18BrFN2O2S — CID 103697791
4-bromo-N-(1,2-dimethylpiperidin-4-yl)-3-fluorobenzenesulfonamide (PubChem CID 103697791) has the molecular formula C13H18BrFN2O2S and a molecular weight of 365.27 g/mol. Its IUPAC name is 4-bromo-N-(1,2-dimethylpiperidin-4-yl)-3-fluorobenzenesulfonamide.
| Compound Name | 4-bromo-N-(1,2-dimethylpiperidin-4-yl)-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 103697791 |
| Molecular Formula | C13H18BrFN2O2S |
| Molecular Weight | 365.27 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | 4-bromo-N-(1,2-dimethylpiperidin-4-yl)-3-fluorobenzenesulfonamide |
| SMILES | CC1CC(NS(=O)(=O)c2ccc(Br)c(F)c2)CCN1C |
| InChI | InChI=1S/C13H18BrFN2O2S/c1-9-7-10(5-6-17(9)2)16-20(18,19)11-3-4-12(14)13(15)8-11/h3-4,8-10,16H,5-7H2,1-2H3 |
| InChIKey | OEQUIGBVFPRFPP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.27 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |