C13H17N3O4S — CID 106997028
4-(aminomethyl)-N-(2,6-dioxopiperidin-3-yl)-2-methylbenzenesulfonamide (PubChem CID 106997028) has the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(2,6-dioxopiperidin-3-yl)-2-methylbenzenesulfonamide.
| Compound Name | 4-(aminomethyl)-N-(2,6-dioxopiperidin-3-yl)-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 106997028 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 4-(aminomethyl)-N-(2,6-dioxopiperidin-3-yl)-2-methylbenzenesulfonamide |
| SMILES | Cc1cc(CN)ccc1S(=O)(=O)NC1CCC(=O)NC1=O |
| InChI | InChI=1S/C13H17N3O4S/c1-8-6-9(7-14)2-4-11(8)21(19,20)16-10-3-5-12(17)15-13(10)18/h2,4,6,10,16H,3,5,7,14H2,1H3,(H,15,17,18) |
| InChIKey | IIKOVLABXQOUKV-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|