C9H12BrNO2S2 — CID 115690365
5-bromo-2-methyl-N-(1-methylcyclopropyl)thiophene-3-sulfonamide (PubChem CID 115690365) has the molecular formula C9H12BrNO2S2 and a molecular weight of 310.24 g/mol. Its IUPAC name is 5-bromo-2-methyl-N-(1-methylcyclopropyl)thiophene-3-sulfonamide.
| Compound Name | 5-bromo-2-methyl-N-(1-methylcyclopropyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 115690365 |
| Molecular Formula | C9H12BrNO2S2 |
| Molecular Weight | 310.24 g/mol |
| Exact Mass | 308.95 |
| IUPAC Name | 5-bromo-2-methyl-N-(1-methylcyclopropyl)thiophene-3-sulfonamide |
| SMILES | Cc1sc(Br)cc1S(=O)(=O)NC1(C)CC1 |
| InChI | InChI=1S/C9H12BrNO2S2/c1-6-7(5-8(10)14-6)15(12,13)11-9(2)3-4-9/h5,11H,3-4H2,1-2H3 |
| InChIKey | WVIVKVHMPZWSTA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.24 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |