About 3-bromo-5-(3,3-difluoroazetidin-1-yl)sulfonylpyridine
3-bromo-5-(3,3-difluoroazetidin-1-yl)sulfonylpyridine (PubChem CID 58522069) has the molecular formula C8H7BrF2N2O2S
and a molecular weight of 313.12 g/mol. Its IUPAC name is 3-bromo-5-(3,3-difluoroazetidin-1-yl)sulfonylpyridine.
Molecular Properties
| Compound Name | 3-bromo-5-(3,3-difluoroazetidin-1-yl)sulfonylpyridine |
| PubChem CID | 58522069 |
| Molecular Formula | C8H7BrF2N2O2S |
| Molecular Weight | 313.12 g/mol |
| Exact Mass | 311.94 |
| IUPAC Name | 3-bromo-5-(3,3-difluoroazetidin-1-yl)sulfonylpyridine |
| SMILES | O=S(=O)(c1cncc(Br)c1)N1CC(F)(F)C1 |
| InChI | InChI=1S/C8H7BrF2N2O2S/c9-6-1-7(3-12-2-6)16(14,15)13-4-8(10,11)5-13/h1-3H,4-5H2 |
| InChIKey | MJJDVUDYPXNVLS-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.12 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-bromo-5-(3,3-difluoroazetidin-1-yl)sulfonylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-5-(3,3-difluoroazetidin-1-yl)sulfonylpyridine?
The IUPAC name of 3-bromo-5-(3,3-difluoroazetidin-1-yl)sulfonylpyridine (CID 58522069) is 3-bromo-5-(3,3-difluoroazetidin-1-yl)sulfonylpyridine.
What is the SMILES notation for 3-bromo-5-(3,3-difluoroazetidin-1-yl)sulfonylpyridine?
The canonical SMILES for 3-bromo-5-(3,3-difluoroazetidin-1-yl)sulfonylpyridine is O=S(=O)(c1cncc(Br)c1)N1CC(F)(F)C1.
What is the InChIKey of 3-bromo-5-(3,3-difluoroazetidin-1-yl)sulfonylpyridine?
The InChIKey is MJJDVUDYPXNVLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrF2N2O2S/c9-6-1-7(3-12-2-6)16(14,15)13-4-8(10,11)5-13/h1-3H,4-5H2.
What are the key properties of 3-bromo-5-(3,3-difluoroazetidin-1-yl)sulfonylpyridine?
3-bromo-5-(3,3-difluoroazetidin-1-yl)sulfonylpyridine has a molecular weight of 313.12 g/mol, XLogP of 1.48, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-5-(3,3-difluoroazetidin-1-yl)sulfonylpyridine is sourced from PubChem (CID 58522069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).