C13H20ClN3O2S — CID 107163440
6-chloro-N-[(1,4-dimethylpiperidin-4-yl)methyl]pyridine-3-sulfonamide (PubChem CID 107163440) has the molecular formula C13H20ClN3O2S and a molecular weight of 317.84 g/mol. Its IUPAC name is 6-chloro-N-[(1,4-dimethylpiperidin-4-yl)methyl]pyridine-3-sulfonamide.
| Compound Name | 6-chloro-N-[(1,4-dimethylpiperidin-4-yl)methyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 107163440 |
| Molecular Formula | C13H20ClN3O2S |
| Molecular Weight | 317.84 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 6-chloro-N-[(1,4-dimethylpiperidin-4-yl)methyl]pyridine-3-sulfonamide |
| SMILES | CN1CCC(C)(CNS(=O)(=O)c2ccc(Cl)nc2)CC1 |
| InChI | InChI=1S/C13H20ClN3O2S/c1-13(5-7-17(2)8-6-13)10-16-20(18,19)11-3-4-12(14)15-9-11/h3-4,9,16H,5-8,10H2,1-2H3 |
| InChIKey | PTTDKPCXIKVIHD-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.84 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|