C13H19ClN4O3S — CID 55697943
N-[2-(4-acetylpiperazin-1-yl)ethyl]-6-chloropyridine-3-sulfonamide (PubChem CID 55697943) has the molecular formula C13H19ClN4O3S and a molecular weight of 346.84 g/mol. Its IUPAC name is N-[2-(4-acetylpiperazin-1-yl)ethyl]-6-chloropyridine-3-sulfonamide.
| Compound Name | N-[2-(4-acetylpiperazin-1-yl)ethyl]-6-chloropyridine-3-sulfonamide |
|---|---|
| PubChem CID | 55697943 |
| Molecular Formula | C13H19ClN4O3S |
| Molecular Weight | 346.84 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | N-[2-(4-acetylpiperazin-1-yl)ethyl]-6-chloropyridine-3-sulfonamide |
| SMILES | CC(=O)N1CCN(CCNS(=O)(=O)c2ccc(Cl)nc2)CC1 |
| InChI | InChI=1S/C13H19ClN4O3S/c1-11(19)18-8-6-17(7-9-18)5-4-16-22(20,21)12-2-3-13(14)15-10-12/h2-3,10,16H,4-9H2,1H3 |
| InChIKey | XRWMDXVRXBVVIS-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.84 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|