C12H15N3O5S — CID 66369933
3-nitro-4-(8-oxa-3-azabicyclo[3.2.1]octan-3-ylsulfonyl)aniline (PubChem CID 66369933) has the molecular formula C12H15N3O5S and a molecular weight of 313.33 g/mol. Its IUPAC name is 3-nitro-4-(8-oxa-3-azabicyclo[3.2.1]octan-3-ylsulfonyl)aniline.
| Compound Name | 3-nitro-4-(8-oxa-3-azabicyclo[3.2.1]octan-3-ylsulfonyl)aniline |
|---|---|
| PubChem CID | 66369933 |
| Molecular Formula | C12H15N3O5S |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 3-nitro-4-(8-oxa-3-azabicyclo[3.2.1]octan-3-ylsulfonyl)aniline |
| SMILES | Nc1ccc(S(=O)(=O)N2CC3CCC(C2)O3)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H15N3O5S/c13-8-1-4-12(11(5-8)15(16)17)21(18,19)14-6-9-2-3-10(7-14)20-9/h1,4-5,9-10H,2-3,6-7,13H2 |
| InChIKey | MJPKCFOAIDHFNC-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 115.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|