C11H16N4O3S2 — CID 106266443
7-[5-(aminomethyl)thiophen-2-yl]sulfonyl-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one (PubChem CID 106266443) has the molecular formula C11H16N4O3S2 and a molecular weight of 316.41 g/mol. Its IUPAC name is 7-[5-(aminomethyl)thiophen-2-yl]sulfonyl-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one.
| Compound Name | 7-[5-(aminomethyl)thiophen-2-yl]sulfonyl-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
|---|---|
| PubChem CID | 106266443 |
| Molecular Formula | C11H16N4O3S2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 7-[5-(aminomethyl)thiophen-2-yl]sulfonyl-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
| SMILES | NCc1ccc(S(=O)(=O)N2CCN3C(=O)NCC3C2)s1 |
| InChI | InChI=1S/C11H16N4O3S2/c12-5-9-1-2-10(19-9)20(17,18)14-3-4-15-8(7-14)6-13-11(15)16/h1-2,8H,3-7,12H2,(H,13,16) |
| InChIKey | SFXDLGFWEPBNDR-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |