C11H11F2NO5S — CID 107215050
3,4-difluoro-5-[(3R)-3-hydroxypyrrolidin-1-yl]sulfonylbenzoic acid (PubChem CID 107215050) has the molecular formula C11H11F2NO5S and a molecular weight of 307.27 g/mol. Its IUPAC name is 3,4-difluoro-5-[(3R)-3-hydroxypyrrolidin-1-yl]sulfonylbenzoic acid.
| Compound Name | 3,4-difluoro-5-[(3R)-3-hydroxypyrrolidin-1-yl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 107215050 |
| Molecular Formula | C11H11F2NO5S |
| Molecular Weight | 307.27 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | 3,4-difluoro-5-[(3R)-3-hydroxypyrrolidin-1-yl]sulfonylbenzoic acid |
| SMILES | O=C(O)c1cc(F)c(F)c(S(=O)(=O)N2CC[C@@H](O)C2)c1 |
| InChI | InChI=1S/C11H11F2NO5S/c12-8-3-6(11(16)17)4-9(10(8)13)20(18,19)14-2-1-7(15)5-14/h3-4,7,15H,1-2,5H2,(H,16,17)/t7-/m1/s1 |
| InChIKey | GIZFOHSSZKGJKB-SSDOTTSWSA-N |
| XLogP | 0.42 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.27 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |