C16H22ClNO2S — CID 115562776
2-[3-(chloromethyl)-4-ethylphenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole (PubChem CID 115562776) has the molecular formula C16H22ClNO2S and a molecular weight of 327.88 g/mol. Its IUPAC name is 2-[3-(chloromethyl)-4-ethylphenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole.
| Compound Name | 2-[3-(chloromethyl)-4-ethylphenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 115562776 |
| Molecular Formula | C16H22ClNO2S |
| Molecular Weight | 327.88 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 2-[3-(chloromethyl)-4-ethylphenyl]sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
| SMILES | CCc1ccc(S(=O)(=O)N2CC3CCCC3C2)cc1CCl |
| InChI | InChI=1S/C16H22ClNO2S/c1-2-12-6-7-16(8-15(12)9-17)21(19,20)18-10-13-4-3-5-14(13)11-18/h6-8,13-14H,2-5,9-11H2,1H3 |
| InChIKey | ZWXUPTIXLMHOTO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.88 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|