C11H14BrClN2O2S2 — CID 113238159
4-[(5-bromo-2-chloro-3-pyridinyl)sulfonyl]-2,3-dimethylthiomorpholine (PubChem CID 113238159) has the molecular formula C11H14BrClN2O2S2 and a molecular weight of 385.74 g/mol. Its IUPAC name is 4-[(5-bromo-2-chloro-3-pyridinyl)sulfonyl]-2,3-dimethylthiomorpholine.
| Compound Name | 4-[(5-bromo-2-chloro-3-pyridinyl)sulfonyl]-2,3-dimethylthiomorpholine |
|---|---|
| PubChem CID | 113238159 |
| Molecular Formula | C11H14BrClN2O2S2 |
| Molecular Weight | 385.74 g/mol |
| Exact Mass | 383.94 |
| IUPAC Name | 4-[(5-bromo-2-chloro-3-pyridinyl)sulfonyl]-2,3-dimethylthiomorpholine |
| SMILES | CC1SCCN(S(=O)(=O)c2cc(Br)cnc2Cl)C1C |
| InChI | InChI=1S/C11H14BrClN2O2S2/c1-7-8(2)18-4-3-15(7)19(16,17)10-5-9(12)6-14-11(10)13/h5-8H,3-4H2,1-2H3 |
| InChIKey | BYMGGSRTHXBILC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.74 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|