C12H16BrClN2O2S — CID 62332316
5-bromo-2-chloro-3-(2,4-dimethylpiperidin-1-yl)sulfonylpyridine (PubChem CID 62332316) has the molecular formula C12H16BrClN2O2S and a molecular weight of 367.70 g/mol. Its IUPAC name is 5-bromo-2-chloro-3-(2,4-dimethylpiperidin-1-yl)sulfonylpyridine.
| Compound Name | 5-bromo-2-chloro-3-(2,4-dimethylpiperidin-1-yl)sulfonylpyridine |
|---|---|
| PubChem CID | 62332316 |
| Molecular Formula | C12H16BrClN2O2S |
| Molecular Weight | 367.70 g/mol |
| Exact Mass | 365.98 |
| IUPAC Name | 5-bromo-2-chloro-3-(2,4-dimethylpiperidin-1-yl)sulfonylpyridine |
| SMILES | CC1CCN(S(=O)(=O)c2cc(Br)cnc2Cl)C(C)C1 |
| InChI | InChI=1S/C12H16BrClN2O2S/c1-8-3-4-16(9(2)5-8)19(17,18)11-6-10(13)7-15-12(11)14/h6-9H,3-5H2,1-2H3 |
| InChIKey | YUCQLCBTWXDKBZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.70 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|