C12H18N2O4S3 — CID 66383160
3-methyl-2-(3-methylsulfonylthiomorpholin-4-yl)sulfonylaniline (PubChem CID 66383160) has the molecular formula C12H18N2O4S3 and a molecular weight of 350.49 g/mol. Its IUPAC name is 3-methyl-2-(3-methylsulfonylthiomorpholin-4-yl)sulfonylaniline.
| Compound Name | 3-methyl-2-(3-methylsulfonylthiomorpholin-4-yl)sulfonylaniline |
|---|---|
| PubChem CID | 66383160 |
| Molecular Formula | C12H18N2O4S3 |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | 3-methyl-2-(3-methylsulfonylthiomorpholin-4-yl)sulfonylaniline |
| SMILES | Cc1cccc(N)c1S(=O)(=O)N1CCSCC1S(C)(=O)=O |
| InChI | InChI=1S/C12H18N2O4S3/c1-9-4-3-5-10(13)12(9)21(17,18)14-6-7-19-8-11(14)20(2,15)16/h3-5,11H,6-8,13H2,1-2H3 |
| InChIKey | IJGRTHUDMGNYRM-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|