C11H15FN2O4S3 — CID 66383350
4-fluoro-2-(3-methylsulfonylthiomorpholin-4-yl)sulfonylaniline (PubChem CID 66383350) has the molecular formula C11H15FN2O4S3 and a molecular weight of 354.45 g/mol. Its IUPAC name is 4-fluoro-2-(3-methylsulfonylthiomorpholin-4-yl)sulfonylaniline.
| Compound Name | 4-fluoro-2-(3-methylsulfonylthiomorpholin-4-yl)sulfonylaniline |
|---|---|
| PubChem CID | 66383350 |
| Molecular Formula | C11H15FN2O4S3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.02 |
| IUPAC Name | 4-fluoro-2-(3-methylsulfonylthiomorpholin-4-yl)sulfonylaniline |
| SMILES | CS(=O)(=O)C1CSCCN1S(=O)(=O)c1cc(F)ccc1N |
| InChI | InChI=1S/C11H15FN2O4S3/c1-20(15,16)11-7-19-5-4-14(11)21(17,18)10-6-8(12)2-3-9(10)13/h2-3,6,11H,4-5,7,13H2,1H3 |
| InChIKey | BKFXTSPDYUVMHE-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|