C13H18N2O4S2 — CID 61116708
ethyl 4-(3-aminophenyl)sulfonylthiomorpholine-3-carboxylate (PubChem CID 61116708) has the molecular formula C13H18N2O4S2 and a molecular weight of 330.43 g/mol. Its IUPAC name is ethyl 4-(3-aminophenyl)sulfonylthiomorpholine-3-carboxylate.
| Compound Name | ethyl 4-(3-aminophenyl)sulfonylthiomorpholine-3-carboxylate |
|---|---|
| PubChem CID | 61116708 |
| Molecular Formula | C13H18N2O4S2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | ethyl 4-(3-aminophenyl)sulfonylthiomorpholine-3-carboxylate |
| SMILES | CCOC(=O)C1CSCCN1S(=O)(=O)c1cccc(N)c1 |
| InChI | InChI=1S/C13H18N2O4S2/c1-2-19-13(16)12-9-20-7-6-15(12)21(17,18)11-5-3-4-10(14)8-11/h3-5,8,12H,2,6-7,9,14H2,1H3 |
| InChIKey | MAQACDOOGPCQAH-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|