C11H17N3O4S3 — CID 66383129
5-(3-ethylsulfonylthiomorpholin-4-yl)sulfonylpyridin-2-amine (PubChem CID 66383129) has the molecular formula C11H17N3O4S3 and a molecular weight of 351.48 g/mol. Its IUPAC name is 5-(3-ethylsulfonylthiomorpholin-4-yl)sulfonylpyridin-2-amine.
| Compound Name | 5-(3-ethylsulfonylthiomorpholin-4-yl)sulfonylpyridin-2-amine |
|---|---|
| PubChem CID | 66383129 |
| Molecular Formula | C11H17N3O4S3 |
| Molecular Weight | 351.48 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | 5-(3-ethylsulfonylthiomorpholin-4-yl)sulfonylpyridin-2-amine |
| SMILES | CCS(=O)(=O)C1CSCCN1S(=O)(=O)c1ccc(N)nc1 |
| InChI | InChI=1S/C11H17N3O4S3/c1-2-20(15,16)11-8-19-6-5-14(11)21(17,18)9-3-4-10(12)13-7-9/h3-4,7,11H,2,5-6,8H2,1H3,(H2,12,13) |
| InChIKey | UJMAUPBTGHSPTP-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 110.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.48 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |