C11H17NO5S4 — CID 66377401
[4-(3-ethylsulfonylthiomorpholin-4-yl)sulfonylthiophen-2-yl]methanol (PubChem CID 66377401) has the molecular formula C11H17NO5S4 and a molecular weight of 371.53 g/mol. Its IUPAC name is [4-(3-ethylsulfonylthiomorpholin-4-yl)sulfonylthiophen-2-yl]methanol.
| Compound Name | [4-(3-ethylsulfonylthiomorpholin-4-yl)sulfonylthiophen-2-yl]methanol |
|---|---|
| PubChem CID | 66377401 |
| Molecular Formula | C11H17NO5S4 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.00 |
| IUPAC Name | [4-(3-ethylsulfonylthiomorpholin-4-yl)sulfonylthiophen-2-yl]methanol |
| SMILES | CCS(=O)(=O)C1CSCCN1S(=O)(=O)c1csc(CO)c1 |
| InChI | InChI=1S/C11H17NO5S4/c1-2-20(14,15)11-8-18-4-3-12(11)21(16,17)10-5-9(6-13)19-7-10/h5,7,11,13H,2-4,6,8H2,1H3 |
| InChIKey | IBEGIBANTGBGIS-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |