C14H21NO3S2 — CID 66378089
[4-(3-ethylsulfonylthiomorpholin-4-yl)-3-methylphenyl]methanol (PubChem CID 66378089) has the molecular formula C14H21NO3S2 and a molecular weight of 315.46 g/mol. Its IUPAC name is [4-(3-ethylsulfonylthiomorpholin-4-yl)-3-methylphenyl]methanol.
| Compound Name | [4-(3-ethylsulfonylthiomorpholin-4-yl)-3-methylphenyl]methanol |
|---|---|
| PubChem CID | 66378089 |
| Molecular Formula | C14H21NO3S2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | [4-(3-ethylsulfonylthiomorpholin-4-yl)-3-methylphenyl]methanol |
| SMILES | CCS(=O)(=O)C1CSCCN1c1ccc(CO)cc1C |
| InChI | InChI=1S/C14H21NO3S2/c1-3-20(17,18)14-10-19-7-6-15(14)13-5-4-12(9-16)8-11(13)2/h4-5,8,14,16H,3,6-7,9-10H2,1-2H3 |
| InChIKey | BNPUJTWRADWJPR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|