C13H19BrN2O2S2 — CID 114889729
[5-bromo-2-(3-ethylsulfonylthiomorpholin-4-yl)phenyl]methanamine (PubChem CID 114889729) has the molecular formula C13H19BrN2O2S2 and a molecular weight of 379.35 g/mol. Its IUPAC name is [5-bromo-2-(3-ethylsulfonylthiomorpholin-4-yl)phenyl]methanamine.
| Compound Name | [5-bromo-2-(3-ethylsulfonylthiomorpholin-4-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 114889729 |
| Molecular Formula | C13H19BrN2O2S2 |
| Molecular Weight | 379.35 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | [5-bromo-2-(3-ethylsulfonylthiomorpholin-4-yl)phenyl]methanamine |
| SMILES | CCS(=O)(=O)C1CSCCN1c1ccc(Br)cc1CN |
| InChI | InChI=1S/C13H19BrN2O2S2/c1-2-20(17,18)13-9-19-6-5-16(13)12-4-3-11(14)7-10(12)8-15/h3-4,7,13H,2,5-6,8-9,15H2,1H3 |
| InChIKey | SUOLCSBKYKEUFY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |