C14H18FNO3S2 — CID 66384669
1-[4-(3-ethylsulfonylthiomorpholin-4-yl)-3-fluorophenyl]ethanone (PubChem CID 66384669) has the molecular formula C14H18FNO3S2 and a molecular weight of 331.43 g/mol. Its IUPAC name is 1-[4-(3-ethylsulfonylthiomorpholin-4-yl)-3-fluorophenyl]ethanone.
| Compound Name | 1-[4-(3-ethylsulfonylthiomorpholin-4-yl)-3-fluorophenyl]ethanone |
|---|---|
| PubChem CID | 66384669 |
| Molecular Formula | C14H18FNO3S2 |
| Molecular Weight | 331.43 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 1-[4-(3-ethylsulfonylthiomorpholin-4-yl)-3-fluorophenyl]ethanone |
| SMILES | CCS(=O)(=O)C1CSCCN1c1ccc(C(C)=O)cc1F |
| InChI | InChI=1S/C14H18FNO3S2/c1-3-21(18,19)14-9-20-7-6-16(14)13-5-4-11(10(2)17)8-12(13)15/h4-5,8,14H,3,6-7,9H2,1-2H3 |
| InChIKey | MGETWQHMYAVCQM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.43 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |