C14H20FNO3S2 — CID 79035720
(1R)-1-[2-(3-ethylsulfonylthiomorpholin-4-yl)-6-fluorophenyl]ethanol (PubChem CID 79035720) has the molecular formula C14H20FNO3S2 and a molecular weight of 333.45 g/mol. Its IUPAC name is (1R)-1-[2-(3-ethylsulfonylthiomorpholin-4-yl)-6-fluorophenyl]ethanol.
| Compound Name | (1R)-1-[2-(3-ethylsulfonylthiomorpholin-4-yl)-6-fluorophenyl]ethanol |
|---|---|
| PubChem CID | 79035720 |
| Molecular Formula | C14H20FNO3S2 |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | (1R)-1-[2-(3-ethylsulfonylthiomorpholin-4-yl)-6-fluorophenyl]ethanol |
| SMILES | CCS(=O)(=O)C1CSCCN1c1cccc(F)c1[C@@H](C)O |
| InChI | InChI=1S/C14H20FNO3S2/c1-3-21(18,19)13-9-20-8-7-16(13)12-6-4-5-11(15)14(12)10(2)17/h4-6,10,13,17H,3,7-9H2,1-2H3/t10-,13?/m1/s1 |
| InChIKey | NODVFJMIIOAYIH-VUUHIHSGSA-N |
| XLogP | 2.19 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |