C14H20BrNO2S2 — CID 107084326
4-[4-(bromomethyl)-2-methylphenyl]-3-ethylsulfonylthiomorpholine (PubChem CID 107084326) has the molecular formula C14H20BrNO2S2 and a molecular weight of 378.36 g/mol. Its IUPAC name is 4-[4-(bromomethyl)-2-methylphenyl]-3-ethylsulfonylthiomorpholine.
| Compound Name | 4-[4-(bromomethyl)-2-methylphenyl]-3-ethylsulfonylthiomorpholine |
|---|---|
| PubChem CID | 107084326 |
| Molecular Formula | C14H20BrNO2S2 |
| Molecular Weight | 378.36 g/mol |
| Exact Mass | 377.01 |
| IUPAC Name | 4-[4-(bromomethyl)-2-methylphenyl]-3-ethylsulfonylthiomorpholine |
| SMILES | CCS(=O)(=O)C1CSCCN1c1ccc(CBr)cc1C |
| InChI | InChI=1S/C14H20BrNO2S2/c1-3-20(17,18)14-10-19-7-6-16(14)13-5-4-12(9-15)8-11(13)2/h4-5,8,14H,3,6-7,9-10H2,1-2H3 |
| InChIKey | DFMJOUWZECYDQL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|