C11H17ClN2O4S3 — CID 66376586
4-[[5-(chloromethyl)-1H-pyrrol-3-yl]sulfonyl]-3-ethylsulfonylthiomorpholine (PubChem CID 66376586) has the molecular formula C11H17ClN2O4S3 and a molecular weight of 372.92 g/mol. Its IUPAC name is 4-[[5-(chloromethyl)-1H-pyrrol-3-yl]sulfonyl]-3-ethylsulfonylthiomorpholine.
| Compound Name | 4-[[5-(chloromethyl)-1H-pyrrol-3-yl]sulfonyl]-3-ethylsulfonylthiomorpholine |
|---|---|
| PubChem CID | 66376586 |
| Molecular Formula | C11H17ClN2O4S3 |
| Molecular Weight | 372.92 g/mol |
| Exact Mass | 372.00 |
| IUPAC Name | 4-[[5-(chloromethyl)-1H-pyrrol-3-yl]sulfonyl]-3-ethylsulfonylthiomorpholine |
| SMILES | CCS(=O)(=O)C1CSCCN1S(=O)(=O)c1c[nH]c(CCl)c1 |
| InChI | InChI=1S/C11H17ClN2O4S3/c1-2-20(15,16)11-8-19-4-3-14(11)21(17,18)10-5-9(6-12)13-7-10/h5,7,11,13H,2-4,6,8H2,1H3 |
| InChIKey | TZSDAOPFTSDLIH-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 87.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.92 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|