C9H14N4O2S2 — CID 79915838
4-(3-methylsulfonylthiomorpholin-4-yl)pyrimidin-5-amine (PubChem CID 79915838) has the molecular formula C9H14N4O2S2 and a molecular weight of 274.37 g/mol. Its IUPAC name is 4-(3-methylsulfonylthiomorpholin-4-yl)pyrimidin-5-amine.
| Compound Name | 4-(3-methylsulfonylthiomorpholin-4-yl)pyrimidin-5-amine |
|---|---|
| PubChem CID | 79915838 |
| Molecular Formula | C9H14N4O2S2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 4-(3-methylsulfonylthiomorpholin-4-yl)pyrimidin-5-amine |
| SMILES | CS(=O)(=O)C1CSCCN1c1ncncc1N |
| InChI | InChI=1S/C9H14N4O2S2/c1-17(14,15)8-5-16-3-2-13(8)9-7(10)4-11-6-12-9/h4,6,8H,2-3,5,10H2,1H3 |
| InChIKey | PIMAAGCMEFKUCV-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |