C11H18N4O2S2 — CID 80851039
6-(3-ethylsulfonylthiomorpholin-4-yl)-5-methylpyrimidin-4-amine (PubChem CID 80851039) has the molecular formula C11H18N4O2S2 and a molecular weight of 302.43 g/mol. Its IUPAC name is 6-(3-ethylsulfonylthiomorpholin-4-yl)-5-methylpyrimidin-4-amine.
| Compound Name | 6-(3-ethylsulfonylthiomorpholin-4-yl)-5-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80851039 |
| Molecular Formula | C11H18N4O2S2 |
| Molecular Weight | 302.43 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 6-(3-ethylsulfonylthiomorpholin-4-yl)-5-methylpyrimidin-4-amine |
| SMILES | CCS(=O)(=O)C1CSCCN1c1ncnc(N)c1C |
| InChI | InChI=1S/C11H18N4O2S2/c1-3-19(16,17)9-6-18-5-4-15(9)11-8(2)10(12)13-7-14-11/h7,9H,3-6H2,1-2H3,(H2,12,13,14) |
| InChIKey | OZWYOIIHIGNMBV-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.43 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |