C12H18N2O3S2 — CID 66376741
[2-(3-ethylsulfonylthiomorpholin-4-yl)-3-pyridinyl]methanol (PubChem CID 66376741) has the molecular formula C12H18N2O3S2 and a molecular weight of 302.42 g/mol. Its IUPAC name is [2-(3-ethylsulfonylthiomorpholin-4-yl)-3-pyridinyl]methanol.
| Compound Name | [2-(3-ethylsulfonylthiomorpholin-4-yl)-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 66376741 |
| Molecular Formula | C12H18N2O3S2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | [2-(3-ethylsulfonylthiomorpholin-4-yl)-3-pyridinyl]methanol |
| SMILES | CCS(=O)(=O)C1CSCCN1c1ncccc1CO |
| InChI | InChI=1S/C12H18N2O3S2/c1-2-19(16,17)11-9-18-7-6-14(11)12-10(8-15)4-3-5-13-12/h3-5,11,15H,2,6-9H2,1H3 |
| InChIKey | OUPGSVYVKPMZOD-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |