C10H14IN3O2S2 — CID 66376036
3-ethylsulfonyl-4-(5-iodopyrimidin-4-yl)thiomorpholine (PubChem CID 66376036) has the molecular formula C10H14IN3O2S2 and a molecular weight of 399.28 g/mol. Its IUPAC name is 3-ethylsulfonyl-4-(5-iodopyrimidin-4-yl)thiomorpholine.
| Compound Name | 3-ethylsulfonyl-4-(5-iodopyrimidin-4-yl)thiomorpholine |
|---|---|
| PubChem CID | 66376036 |
| Molecular Formula | C10H14IN3O2S2 |
| Molecular Weight | 399.28 g/mol |
| Exact Mass | 398.96 |
| IUPAC Name | 3-ethylsulfonyl-4-(5-iodopyrimidin-4-yl)thiomorpholine |
| SMILES | CCS(=O)(=O)C1CSCCN1c1ncncc1I |
| InChI | InChI=1S/C10H14IN3O2S2/c1-2-18(15,16)9-6-17-4-3-14(9)10-8(11)5-12-7-13-10/h5,7,9H,2-4,6H2,1H3 |
| InChIKey | RYKUBAAVGDDWDN-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.28 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|