C13H23N3O2S3 — CID 66377163
N-[[2-(3-ethylsulfonylthiomorpholin-4-yl)-1,3-thiazol-5-yl]methyl]propan-1-amine (PubChem CID 66377163) has the molecular formula C13H23N3O2S3 and a molecular weight of 349.55 g/mol. Its IUPAC name is N-[[2-(3-ethylsulfonylthiomorpholin-4-yl)-1,3-thiazol-5-yl]methyl]propan-1-amine.
| Compound Name | N-[[2-(3-ethylsulfonylthiomorpholin-4-yl)-1,3-thiazol-5-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 66377163 |
| Molecular Formula | C13H23N3O2S3 |
| Molecular Weight | 349.55 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | N-[[2-(3-ethylsulfonylthiomorpholin-4-yl)-1,3-thiazol-5-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cnc(N2CCSCC2S(=O)(=O)CC)s1 |
| InChI | InChI=1S/C13H23N3O2S3/c1-3-5-14-8-11-9-15-13(20-11)16-6-7-19-10-12(16)21(17,18)4-2/h9,12,14H,3-8,10H2,1-2H3 |
| InChIKey | KJMZZDUQBVOKQL-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.55 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|