C14H17N3O2S2 — CID 103963434
4-(3-methylsulfonylthiomorpholin-4-yl)quinolin-3-amine (PubChem CID 103963434) has the molecular formula C14H17N3O2S2 and a molecular weight of 323.44 g/mol. Its IUPAC name is 4-(3-methylsulfonylthiomorpholin-4-yl)quinolin-3-amine.
| Compound Name | 4-(3-methylsulfonylthiomorpholin-4-yl)quinolin-3-amine |
|---|---|
| PubChem CID | 103963434 |
| Molecular Formula | C14H17N3O2S2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 4-(3-methylsulfonylthiomorpholin-4-yl)quinolin-3-amine |
| SMILES | CS(=O)(=O)C1CSCCN1c1c(N)cnc2ccccc12 |
| InChI | InChI=1S/C14H17N3O2S2/c1-21(18,19)13-9-20-7-6-17(13)14-10-4-2-3-5-12(10)16-8-11(14)15/h2-5,8,13H,6-7,9,15H2,1H3 |
| InChIKey | DZIMNGUDLUJBAB-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |